C20H14ClFN2O4 — CID 97011955
5-(2-chloro-4-nitrophenyl)-N-[(1S,2S)-2-(4-fluorophenyl)cyclopropyl]furan-2-carboxamide (PubChem CID 97011955) has the molecular formula C20H14ClFN2O4 and a molecular weight of 400.79 g/mol. Its IUPAC name is 5-(2-chloro-4-nitrophenyl)-N-[(1S,2S)-2-(4-fluorophenyl)cyclopropyl]furan-2-carboxamide.
| Compound Name | 5-(2-chloro-4-nitrophenyl)-N-[(1S,2S)-2-(4-fluorophenyl)cyclopropyl]furan-2-carboxamide |
|---|---|
| PubChem CID | 97011955 |
| Molecular Formula | C20H14ClFN2O4 |
| Molecular Weight | 400.79 g/mol |
| Exact Mass | 400.06 |
| IUPAC Name | 5-(2-chloro-4-nitrophenyl)-N-[(1S,2S)-2-(4-fluorophenyl)cyclopropyl]furan-2-carboxamide |
| SMILES | O=C(N[C@H]1C[C@H]1c1ccc(F)cc1)c1ccc(-c2ccc([N+](=O)[O-])cc2Cl)o1 |
| InChI | InChI=1S/C20H14ClFN2O4/c21-16-9-13(24(26)27)5-6-14(16)18-7-8-19(28-18)20(25)23-17-10-15(17)11-1-3-12(22)4-2-11/h1-9,15,17H,10H2,(H,23,25)/t15-,17-/m0/s1 |
| InChIKey | PBKWUTLBCJRWMT-RDJZCZTQSA-N |
| XLogP | 4.93 |
| TPSA | 85.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.79 |
| LogP ≤ 5 | 4.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|