C21H19ClN2O6 — CID 1424128
5-(2-chloro-4-nitrophenyl)-N-[2-(3,4-dimethoxyphenyl)ethyl]furan-2-carboxamide (PubChem CID 1424128) has the molecular formula C21H19ClN2O6 and a molecular weight of 430.84 g/mol. Its IUPAC name is 5-(2-chloro-4-nitrophenyl)-N-[2-(3,4-dimethoxyphenyl)ethyl]furan-2-carboxamide.
| Compound Name | 5-(2-chloro-4-nitrophenyl)-N-[2-(3,4-dimethoxyphenyl)ethyl]furan-2-carboxamide |
|---|---|
| PubChem CID | 1424128 |
| Molecular Formula | C21H19ClN2O6 |
| Molecular Weight | 430.84 g/mol |
| Exact Mass | 430.09 |
| IUPAC Name | 5-(2-chloro-4-nitrophenyl)-N-[2-(3,4-dimethoxyphenyl)ethyl]furan-2-carboxamide |
| SMILES | COc1ccc(CCNC(=O)c2ccc(-c3ccc([N+](=O)[O-])cc3Cl)o2)cc1OC |
| InChI | InChI=1S/C21H19ClN2O6/c1-28-18-6-3-13(11-20(18)29-2)9-10-23-21(25)19-8-7-17(30-19)15-5-4-14(24(26)27)12-16(15)22/h3-8,11-12H,9-10H2,1-2H3,(H,23,25) |
| InChIKey | SGVBDHYNRWMRHS-UHFFFAOYSA-N |
| XLogP | 4.50 |
| TPSA | 103.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.84 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|