C23H22ClN3O7S — CID 3370322
4-[(2-chloro-5-nitrophenyl)sulfonylamino]-N-[2-(3,4-dimethoxyphenyl)ethyl]benzamide (PubChem CID 3370322) has the molecular formula C23H22ClN3O7S and a molecular weight of 519.96 g/mol. Its IUPAC name is 4-[(2-chloro-5-nitrophenyl)sulfonylamino]-N-[2-(3,4-dimethoxyphenyl)ethyl]benzamide.
| Compound Name | 4-[(2-chloro-5-nitrophenyl)sulfonylamino]-N-[2-(3,4-dimethoxyphenyl)ethyl]benzamide |
|---|---|
| PubChem CID | 3370322 |
| Molecular Formula | C23H22ClN3O7S |
| Molecular Weight | 519.96 g/mol |
| Exact Mass | 519.09 |
| IUPAC Name | 4-[(2-chloro-5-nitrophenyl)sulfonylamino]-N-[2-(3,4-dimethoxyphenyl)ethyl]benzamide |
| SMILES | COc1ccc(CCNC(=O)c2ccc(NS(=O)(=O)c3cc([N+](=O)[O-])ccc3Cl)cc2)cc1OC |
| InChI | InChI=1S/C23H22ClN3O7S/c1-33-20-10-3-15(13-21(20)34-2)11-12-25-23(28)16-4-6-17(7-5-16)26-35(31,32)22-14-18(27(29)30)8-9-19(22)24/h3-10,13-14,26H,11-12H2,1-2H3,(H,25,28) |
| InChIKey | ARYSVZVGLHVHRO-UHFFFAOYSA-N |
| XLogP | 4.04 |
| TPSA | 136.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 519.96 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|