C15H18N2O6S — CID 84575585
N-[2-(3,4-dimethoxyphenyl)ethyl]-5-sulfamoylfuran-2-carboxamide (PubChem CID 84575585) has the molecular formula C15H18N2O6S and a molecular weight of 354.38 g/mol. Its IUPAC name is N-[2-(3,4-dimethoxyphenyl)ethyl]-5-sulfamoylfuran-2-carboxamide.
| Compound Name | N-[2-(3,4-dimethoxyphenyl)ethyl]-5-sulfamoylfuran-2-carboxamide |
|---|---|
| PubChem CID | 84575585 |
| Molecular Formula | C15H18N2O6S |
| Molecular Weight | 354.38 g/mol |
| Exact Mass | 354.09 |
| IUPAC Name | N-[2-(3,4-dimethoxyphenyl)ethyl]-5-sulfamoylfuran-2-carboxamide |
| SMILES | COc1ccc(CCNC(=O)c2ccc(S(N)(=O)=O)o2)cc1OC |
| InChI | InChI=1S/C15H18N2O6S/c1-21-11-4-3-10(9-13(11)22-2)7-8-17-15(18)12-5-6-14(23-12)24(16,19)20/h3-6,9H,7-8H2,1-2H3,(H,17,18)(H2,16,19,20) |
| InChIKey | AEQVEQBYCKEWOV-UHFFFAOYSA-N |
| XLogP | 0.92 |
| TPSA | 120.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.38 |
| LogP ≤ 5 | 0.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |