C22H20N2O6 — CID 18085097
[2-[1-(2-methylphenyl)ethylamino]-2-oxoethyl] 5-(4-nitrophenyl)furan-2-carboxylate (PubChem CID 18085097) has the molecular formula C22H20N2O6 and a molecular weight of 408.41 g/mol. Its IUPAC name is [2-[1-(2-methylphenyl)ethylamino]-2-oxoethyl] 5-(4-nitrophenyl)furan-2-carboxylate.
| Compound Name | [2-[1-(2-methylphenyl)ethylamino]-2-oxoethyl] 5-(4-nitrophenyl)furan-2-carboxylate |
|---|---|
| PubChem CID | 18085097 |
| Molecular Formula | C22H20N2O6 |
| Molecular Weight | 408.41 g/mol |
| Exact Mass | 408.13 |
| IUPAC Name | [2-[1-(2-methylphenyl)ethylamino]-2-oxoethyl] 5-(4-nitrophenyl)furan-2-carboxylate |
| SMILES | Cc1ccccc1C(C)NC(=O)COC(=O)c1ccc(-c2ccc([N+](=O)[O-])cc2)o1 |
| InChI | InChI=1S/C22H20N2O6/c1-14-5-3-4-6-18(14)15(2)23-21(25)13-29-22(26)20-12-11-19(30-20)16-7-9-17(10-8-16)24(27)28/h3-12,15H,13H2,1-2H3,(H,23,25) |
| InChIKey | WWVSBFOYUHMWHQ-UHFFFAOYSA-N |
| XLogP | 4.20 |
| TPSA | 111.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.41 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|