C21H17NO6 — CID 7355801
[2-(2,4-dimethylphenyl)-2-oxoethyl] 5-(4-nitrophenyl)furan-2-carboxylate (PubChem CID 7355801) has the molecular formula C21H17NO6 and a molecular weight of 379.37 g/mol. Its IUPAC name is [2-(2,4-dimethylphenyl)-2-oxoethyl] 5-(4-nitrophenyl)furan-2-carboxylate.
| Compound Name | [2-(2,4-dimethylphenyl)-2-oxoethyl] 5-(4-nitrophenyl)furan-2-carboxylate |
|---|---|
| PubChem CID | 7355801 |
| Molecular Formula | C21H17NO6 |
| Molecular Weight | 379.37 g/mol |
| Exact Mass | 379.11 |
| IUPAC Name | [2-(2,4-dimethylphenyl)-2-oxoethyl] 5-(4-nitrophenyl)furan-2-carboxylate |
| SMILES | Cc1ccc(C(=O)COC(=O)c2ccc(-c3ccc([N+](=O)[O-])cc3)o2)c(C)c1 |
| InChI | InChI=1S/C21H17NO6/c1-13-3-8-17(14(2)11-13)18(23)12-27-21(24)20-10-9-19(28-20)15-4-6-16(7-5-15)22(25)26/h3-11H,12H2,1-2H3 |
| InChIKey | NGGQEBYEGSNNQT-UHFFFAOYSA-N |
| XLogP | 4.51 |
| TPSA | 99.65 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.37 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|