C20H13F3N2O6 — CID 40930170
[2-oxo-2-[2-(trifluoromethyl)anilino]ethyl] 5-(4-nitrophenyl)furan-2-carboxylate (PubChem CID 40930170) has the molecular formula C20H13F3N2O6 and a molecular weight of 434.33 g/mol. Its IUPAC name is [2-oxo-2-[2-(trifluoromethyl)anilino]ethyl] 5-(4-nitrophenyl)furan-2-carboxylate.
| Compound Name | [2-oxo-2-[2-(trifluoromethyl)anilino]ethyl] 5-(4-nitrophenyl)furan-2-carboxylate |
|---|---|
| PubChem CID | 40930170 |
| Molecular Formula | C20H13F3N2O6 |
| Molecular Weight | 434.33 g/mol |
| Exact Mass | 434.07 |
| IUPAC Name | [2-oxo-2-[2-(trifluoromethyl)anilino]ethyl] 5-(4-nitrophenyl)furan-2-carboxylate |
| SMILES | O=C(COC(=O)c1ccc(-c2ccc([N+](=O)[O-])cc2)o1)Nc1ccccc1C(F)(F)F |
| InChI | InChI=1S/C20H13F3N2O6/c21-20(22,23)14-3-1-2-4-15(14)24-18(26)11-30-19(27)17-10-9-16(31-17)12-5-7-13(8-6-12)25(28)29/h1-10H,11H2,(H,24,26) |
| InChIKey | VUWZRVVFSATELX-UHFFFAOYSA-N |
| XLogP | 4.67 |
| TPSA | 111.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.33 |
| LogP ≤ 5 | 4.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|