C18H14BrN5O5 — CID 55516989
[2-(2-bromo-4-nitroanilino)-2-oxoethyl] 1-benzyltriazole-4-carboxylate (PubChem CID 55516989) has the molecular formula C18H14BrN5O5 and a molecular weight of 460.24 g/mol. Its IUPAC name is [2-(2-bromo-4-nitroanilino)-2-oxoethyl] 1-benzyltriazole-4-carboxylate.
| Compound Name | [2-(2-bromo-4-nitroanilino)-2-oxoethyl] 1-benzyltriazole-4-carboxylate |
|---|---|
| PubChem CID | 55516989 |
| Molecular Formula | C18H14BrN5O5 |
| Molecular Weight | 460.24 g/mol |
| Exact Mass | 459.02 |
| IUPAC Name | [2-(2-bromo-4-nitroanilino)-2-oxoethyl] 1-benzyltriazole-4-carboxylate |
| SMILES | O=C(COC(=O)c1cn(Cc2ccccc2)nn1)Nc1ccc([N+](=O)[O-])cc1Br |
| InChI | InChI=1S/C18H14BrN5O5/c19-14-8-13(24(27)28)6-7-15(14)20-17(25)11-29-18(26)16-10-23(22-21-16)9-12-4-2-1-3-5-12/h1-8,10H,9,11H2,(H,20,25) |
| InChIKey | ZPBWNICOOKFTIX-UHFFFAOYSA-N |
| XLogP | 2.79 |
| TPSA | 129.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.24 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|