C25H20N4O5 — CID 55517288
[2-[(2-methoxydibenzofuran-3-yl)amino]-2-oxoethyl] 1-benzyltriazole-4-carboxylate (PubChem CID 55517288) has the molecular formula C25H20N4O5 and a molecular weight of 456.46 g/mol. Its IUPAC name is [2-[(2-methoxydibenzofuran-3-yl)amino]-2-oxoethyl] 1-benzyltriazole-4-carboxylate.
| Compound Name | [2-[(2-methoxydibenzofuran-3-yl)amino]-2-oxoethyl] 1-benzyltriazole-4-carboxylate |
|---|---|
| PubChem CID | 55517288 |
| Molecular Formula | C25H20N4O5 |
| Molecular Weight | 456.46 g/mol |
| Exact Mass | 456.14 |
| IUPAC Name | [2-[(2-methoxydibenzofuran-3-yl)amino]-2-oxoethyl] 1-benzyltriazole-4-carboxylate |
| SMILES | COc1cc2c(cc1NC(=O)COC(=O)c1cn(Cc3ccccc3)nn1)oc1ccccc12 |
| InChI | InChI=1S/C25H20N4O5/c1-32-23-11-18-17-9-5-6-10-21(17)34-22(18)12-19(23)26-24(30)15-33-25(31)20-14-29(28-27-20)13-16-7-3-2-4-8-16/h2-12,14H,13,15H2,1H3,(H,26,30) |
| InChIKey | CKAXHBWBEHDRLT-UHFFFAOYSA-N |
| XLogP | 4.03 |
| TPSA | 108.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.46 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |