C24H21NO6S — CID 16525047
[2-[(2-methoxydibenzofuran-3-yl)amino]-2-oxoethyl] 2-methoxy-4-methylsulfanylbenzoate (PubChem CID 16525047) has the molecular formula C24H21NO6S and a molecular weight of 451.50 g/mol. Its IUPAC name is [2-[(2-methoxydibenzofuran-3-yl)amino]-2-oxoethyl] 2-methoxy-4-methylsulfanylbenzoate.
| Compound Name | [2-[(2-methoxydibenzofuran-3-yl)amino]-2-oxoethyl] 2-methoxy-4-methylsulfanylbenzoate |
|---|---|
| PubChem CID | 16525047 |
| Molecular Formula | C24H21NO6S |
| Molecular Weight | 451.50 g/mol |
| Exact Mass | 451.11 |
| IUPAC Name | [2-[(2-methoxydibenzofuran-3-yl)amino]-2-oxoethyl] 2-methoxy-4-methylsulfanylbenzoate |
| SMILES | COc1cc2c(cc1NC(=O)COC(=O)c1ccc(SC)cc1OC)oc1ccccc12 |
| InChI | InChI=1S/C24H21NO6S/c1-28-20-10-14(32-3)8-9-16(20)24(27)30-13-23(26)25-18-12-21-17(11-22(18)29-2)15-6-4-5-7-19(15)31-21/h4-12H,13H2,1-3H3,(H,25,26) |
| InChIKey | MELXIAXJGWPMSG-UHFFFAOYSA-N |
| XLogP | 5.12 |
| TPSA | 87.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.50 |
| LogP ≤ 5 | 5.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |