C30H19NO7 — CID 4170376
[2-[(2-methoxydibenzofuran-3-yl)amino]-2-oxoethyl] 9,10-dioxoanthracene-1-carboxylate (PubChem CID 4170376) has the molecular formula C30H19NO7 and a molecular weight of 505.48 g/mol. Its IUPAC name is [2-[(2-methoxydibenzofuran-3-yl)amino]-2-oxoethyl] 9,10-dioxoanthracene-1-carboxylate.
| Compound Name | [2-[(2-methoxydibenzofuran-3-yl)amino]-2-oxoethyl] 9,10-dioxoanthracene-1-carboxylate |
|---|---|
| PubChem CID | 4170376 |
| Molecular Formula | C30H19NO7 |
| Molecular Weight | 505.48 g/mol |
| Exact Mass | 505.12 |
| IUPAC Name | [2-[(2-methoxydibenzofuran-3-yl)amino]-2-oxoethyl] 9,10-dioxoanthracene-1-carboxylate |
| SMILES | COc1cc2c(cc1NC(=O)COC(=O)c1cccc3c1C(=O)c1ccccc1C3=O)oc1ccccc12 |
| InChI | InChI=1S/C30H19NO7/c1-36-25-13-21-16-7-4-5-12-23(16)38-24(21)14-22(25)31-26(32)15-37-30(35)20-11-6-10-19-27(20)29(34)18-9-3-2-8-17(18)28(19)33/h2-14H,15H2,1H3,(H,31,32) |
| InChIKey | ARWJIDBIMLUYBT-UHFFFAOYSA-N |
| XLogP | 5.17 |
| TPSA | 111.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 505.48 |
| LogP ≤ 5 | 5.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'} |
|---|