C30H21N3O5 — CID 2435948
[2-[(2-methoxydibenzofuran-3-yl)amino]-2-oxoethyl] 2-pyridin-3-ylquinoline-4-carboxylate (PubChem CID 2435948) has the molecular formula C30H21N3O5 and a molecular weight of 503.51 g/mol. Its IUPAC name is [2-[(2-methoxydibenzofuran-3-yl)amino]-2-oxoethyl] 2-pyridin-3-ylquinoline-4-carboxylate.
| Compound Name | [2-[(2-methoxydibenzofuran-3-yl)amino]-2-oxoethyl] 2-pyridin-3-ylquinoline-4-carboxylate |
|---|---|
| PubChem CID | 2435948 |
| Molecular Formula | C30H21N3O5 |
| Molecular Weight | 503.51 g/mol |
| Exact Mass | 503.15 |
| IUPAC Name | [2-[(2-methoxydibenzofuran-3-yl)amino]-2-oxoethyl] 2-pyridin-3-ylquinoline-4-carboxylate |
| SMILES | COc1cc2c(cc1NC(=O)COC(=O)c1cc(-c3cccnc3)nc3ccccc13)oc1ccccc12 |
| InChI | InChI=1S/C30H21N3O5/c1-36-28-14-21-20-9-3-5-11-26(20)38-27(21)15-25(28)33-29(34)17-37-30(35)22-13-24(18-7-6-12-31-16-18)32-23-10-4-2-8-19(22)23/h2-16H,17H2,1H3,(H,33,34) |
| InChIKey | VBWUWWFCGYAPHS-UHFFFAOYSA-N |
| XLogP | 6.00 |
| TPSA | 103.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 503.51 |
| LogP ≤ 5 | 6.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |