C21H20N2O3 — CID 2401604
(3,3-dimethyl-2-oxobutyl) 2-pyridin-3-ylquinoline-4-carboxylate (PubChem CID 2401604) has the molecular formula C21H20N2O3 and a molecular weight of 348.40 g/mol. Its IUPAC name is (3,3-dimethyl-2-oxobutyl) 2-pyridin-3-ylquinoline-4-carboxylate.
| Compound Name | (3,3-dimethyl-2-oxobutyl) 2-pyridin-3-ylquinoline-4-carboxylate |
|---|---|
| PubChem CID | 2401604 |
| Molecular Formula | C21H20N2O3 |
| Molecular Weight | 348.40 g/mol |
| Exact Mass | 348.15 |
| IUPAC Name | (3,3-dimethyl-2-oxobutyl) 2-pyridin-3-ylquinoline-4-carboxylate |
| SMILES | CC(C)(C)C(=O)COC(=O)c1cc(-c2cccnc2)nc2ccccc12 |
| InChI | InChI=1S/C21H20N2O3/c1-21(2,3)19(24)13-26-20(25)16-11-18(14-7-6-10-22-12-14)23-17-9-5-4-8-15(16)17/h4-12H,13H2,1-3H3 |
| InChIKey | DGWVBWIKWXEZDQ-UHFFFAOYSA-N |
| XLogP | 4.07 |
| TPSA | 69.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.40 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |