C21H23N3O2 — CID 111483666
N-(2-hydroxy-2,3-dimethylbutyl)-2-pyridin-3-ylquinoline-4-carboxamide (PubChem CID 111483666) has the molecular formula C21H23N3O2 and a molecular weight of 349.43 g/mol. Its IUPAC name is N-(2-hydroxy-2,3-dimethylbutyl)-2-pyridin-3-ylquinoline-4-carboxamide.
| Compound Name | N-(2-hydroxy-2,3-dimethylbutyl)-2-pyridin-3-ylquinoline-4-carboxamide |
|---|---|
| PubChem CID | 111483666 |
| Molecular Formula | C21H23N3O2 |
| Molecular Weight | 349.43 g/mol |
| Exact Mass | 349.18 |
| IUPAC Name | N-(2-hydroxy-2,3-dimethylbutyl)-2-pyridin-3-ylquinoline-4-carboxamide |
| SMILES | CC(C)C(C)(O)CNC(=O)c1cc(-c2cccnc2)nc2ccccc12 |
| InChI | InChI=1S/C21H23N3O2/c1-14(2)21(3,26)13-23-20(25)17-11-19(15-7-6-10-22-12-15)24-18-9-5-4-8-16(17)18/h4-12,14,26H,13H2,1-3H3,(H,23,25) |
| InChIKey | OBQXKGBJFPRYQM-UHFFFAOYSA-N |
| XLogP | 3.43 |
| TPSA | 75.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.43 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |