C31H32N2O5 — CID 124716932
(3,3-dimethyl-2-oxobutyl) 2-[3-[(3aS,5R,7aR)-5-methyl-1,3-dioxo-3a,4,5,6,7,7a-hexahydroisoindol-2-yl]phenyl]quinoline-4-carboxylate (PubChem CID 124716932) has the molecular formula C31H32N2O5 and a molecular weight of 512.61 g/mol. Its IUPAC name is (3,3-dimethyl-2-oxobutyl) 2-[3-[(3aS,5R,7aR)-5-methyl-1,3-dioxo-3a,4,5,6,7,7a-hexahydroisoindol-2-yl]phenyl]quinoline-4-carboxylate.
| Compound Name | (3,3-dimethyl-2-oxobutyl) 2-[3-[(3aS,5R,7aR)-5-methyl-1,3-dioxo-3a,4,5,6,7,7a-hexahydroisoindol-2-yl]phenyl]quinoline-4-carboxylate |
|---|---|
| PubChem CID | 124716932 |
| Molecular Formula | C31H32N2O5 |
| Molecular Weight | 512.61 g/mol |
| Exact Mass | 512.23 |
| IUPAC Name | (3,3-dimethyl-2-oxobutyl) 2-[3-[(3aS,5R,7aR)-5-methyl-1,3-dioxo-3a,4,5,6,7,7a-hexahydroisoindol-2-yl]phenyl]quinoline-4-carboxylate |
| SMILES | C[C@@H]1CC[C@H]2C(=O)N(c3cccc(-c4cc(C(=O)OCC(=O)C(C)(C)C)c5ccccc5n4)c3)C(=O)[C@H]2C1 |
| InChI | InChI=1S/C31H32N2O5/c1-18-12-13-22-23(14-18)29(36)33(28(22)35)20-9-7-8-19(15-20)26-16-24(21-10-5-6-11-25(21)32-26)30(37)38-17-27(34)31(2,3)4/h5-11,15-16,18,22-23H,12-14,17H2,1-4H3/t18-,22-,23+/m1/s1 |
| InChIKey | VDOWBOSFHWJPJN-YSZBQJHXSA-N |
| XLogP | 5.60 |
| TPSA | 93.64 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 512.61 |
| LogP ≤ 5 | 5.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|