C30H30N2O5 — CID 27904074
(3,3-dimethyl-2-oxobutyl) 2-[3-[(3aS,7aS)-1,3-dioxo-3a,4,5,6,7,7a-hexahydroisoindol-2-yl]phenyl]quinoline-4-carboxylate (PubChem CID 27904074) has the molecular formula C30H30N2O5 and a molecular weight of 498.58 g/mol. Its IUPAC name is (3,3-dimethyl-2-oxobutyl) 2-[3-[(3aS,7aS)-1,3-dioxo-3a,4,5,6,7,7a-hexahydroisoindol-2-yl]phenyl]quinoline-4-carboxylate.
| Compound Name | (3,3-dimethyl-2-oxobutyl) 2-[3-[(3aS,7aS)-1,3-dioxo-3a,4,5,6,7,7a-hexahydroisoindol-2-yl]phenyl]quinoline-4-carboxylate |
|---|---|
| PubChem CID | 27904074 |
| Molecular Formula | C30H30N2O5 |
| Molecular Weight | 498.58 g/mol |
| Exact Mass | 498.22 |
| IUPAC Name | (3,3-dimethyl-2-oxobutyl) 2-[3-[(3aS,7aS)-1,3-dioxo-3a,4,5,6,7,7a-hexahydroisoindol-2-yl]phenyl]quinoline-4-carboxylate |
| SMILES | CC(C)(C)C(=O)COC(=O)c1cc(-c2cccc(N3C(=O)[C@H]4CCCC[C@@H]4C3=O)c2)nc2ccccc12 |
| InChI | InChI=1S/C30H30N2O5/c1-30(2,3)26(33)17-37-29(36)23-16-25(31-24-14-7-6-11-20(23)24)18-9-8-10-19(15-18)32-27(34)21-12-4-5-13-22(21)28(32)35/h6-11,14-16,21-22H,4-5,12-13,17H2,1-3H3/t21-,22-/m0/s1 |
| InChIKey | JCDJMFVMIDDYDW-VXKWHMMOSA-N |
| XLogP | 5.35 |
| TPSA | 93.64 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.58 |
| LogP ≤ 5 | 5.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|