C25H18N2O4 — CID 3664541
2-[3-(3,5-dioxo-4-azatricyclo[5.2.1.02,6]dec-8-en-4-yl)phenyl]quinoline-4-carboxylic acid (PubChem CID 3664541) has the molecular formula C25H18N2O4 and a molecular weight of 410.43 g/mol. Its IUPAC name is 2-[3-(3,5-dioxo-4-azatricyclo[5.2.1.02,6]dec-8-en-4-yl)phenyl]quinoline-4-carboxylic acid.
| Compound Name | 2-[3-(3,5-dioxo-4-azatricyclo[5.2.1.02,6]dec-8-en-4-yl)phenyl]quinoline-4-carboxylic acid |
|---|---|
| PubChem CID | 3664541 |
| Molecular Formula | C25H18N2O4 |
| Molecular Weight | 410.43 g/mol |
| Exact Mass | 410.13 |
| IUPAC Name | 2-[3-(3,5-dioxo-4-azatricyclo[5.2.1.02,6]dec-8-en-4-yl)phenyl]quinoline-4-carboxylic acid |
| SMILES | O=C(O)c1cc(-c2cccc(N3C(=O)C4C5C=CC(C5)C4C3=O)c2)nc2ccccc12 |
| InChI | InChI=1S/C25H18N2O4/c28-23-21-14-8-9-15(10-14)22(21)24(29)27(23)16-5-3-4-13(11-16)20-12-18(25(30)31)17-6-1-2-7-19(17)26-20/h1-9,11-12,14-15,21-22H,10H2,(H,30,31) |
| InChIKey | GJLLLDIBBXHCSW-UHFFFAOYSA-N |
| XLogP | 3.91 |
| TPSA | 87.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.43 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|