C25H17N2O4- — CID 23375239
2-[3-[(1R,2R,6S,7R)-3,5-dioxo-4-azatricyclo[5.2.1.02,6]dec-8-en-4-yl]phenyl]quinoline-4-carboxylate (PubChem CID 23375239) has the molecular formula C25H17N2O4- and a molecular weight of 409.42 g/mol. Its IUPAC name is 2-[3-[(1R,2R,6S,7R)-3,5-dioxo-4-azatricyclo[5.2.1.02,6]dec-8-en-4-yl]phenyl]quinoline-4-carboxylate.
| Compound Name | 2-[3-[(1R,2R,6S,7R)-3,5-dioxo-4-azatricyclo[5.2.1.02,6]dec-8-en-4-yl]phenyl]quinoline-4-carboxylate |
|---|---|
| PubChem CID | 23375239 |
| Molecular Formula | C25H17N2O4- |
| Molecular Weight | 409.42 g/mol |
| Exact Mass | 409.12 |
| IUPAC Name | 2-[3-[(1R,2R,6S,7R)-3,5-dioxo-4-azatricyclo[5.2.1.02,6]dec-8-en-4-yl]phenyl]quinoline-4-carboxylate |
| SMILES | O=C([O-])c1cc(-c2cccc(N3C(=O)[C@@H]4[C@H](C3=O)[C@H]3C=C[C@H]4C3)c2)nc2ccccc12 |
| InChI | InChI=1S/C25H18N2O4/c28-23-21-14-8-9-15(10-14)22(21)24(29)27(23)16-5-3-4-13(11-16)20-12-18(25(30)31)17-6-1-2-7-19(17)26-20/h1-9,11-12,14-15,21-22H,10H2,(H,30,31)/p-1/t14-,15-,21-,22+/m0/s1 |
| InChIKey | GJLLLDIBBXHCSW-YKTUVVHCSA-M |
| XLogP | 2.58 |
| TPSA | 90.40 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.42 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|