C16H12NO4- — CID 18389050
3-[(1S,2R,6S,7S)-3,5-dioxo-4-azatricyclo[5.2.1.02,6]dec-8-en-4-yl]benzoate (PubChem CID 18389050) has the molecular formula C16H12NO4- and a molecular weight of 282.27 g/mol. Its IUPAC name is 3-[(1S,2R,6S,7S)-3,5-dioxo-4-azatricyclo[5.2.1.02,6]dec-8-en-4-yl]benzoate.
| Compound Name | 3-[(1S,2R,6S,7S)-3,5-dioxo-4-azatricyclo[5.2.1.02,6]dec-8-en-4-yl]benzoate |
|---|---|
| PubChem CID | 18389050 |
| Molecular Formula | C16H12NO4- |
| Molecular Weight | 282.27 g/mol |
| Exact Mass | 282.08 |
| IUPAC Name | 3-[(1S,2R,6S,7S)-3,5-dioxo-4-azatricyclo[5.2.1.02,6]dec-8-en-4-yl]benzoate |
| SMILES | O=C([O-])c1cccc(N2C(=O)[C@@H]3[C@H](C2=O)[C@@H]2C=C[C@@H]3C2)c1 |
| InChI | InChI=1S/C16H13NO4/c18-14-12-8-4-5-9(6-8)13(12)15(19)17(14)11-3-1-2-10(7-11)16(20)21/h1-5,7-9,12-13H,6H2,(H,20,21)/p-1/t8-,9-,12-,13+/m1/s1 |
| InChIKey | UOROWQIYVUQGLN-RQSQLSILSA-M |
| XLogP | 0.36 |
| TPSA | 77.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.27 |
| LogP ≤ 5 | 0.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|