C33H26N2O5 — CID 129431846
(1R,2R,6S,7R)-4-[3-[(Z)-3-[3-[(1R,2R,6R,7R)-3,5-dioxo-4-azatricyclo[5.2.1.02,6]dec-8-en-4-yl]phenyl]-3-oxoprop-1-enyl]phenyl]-4-azatricyclo[5.2.1.02,6]dec-8-ene-3,5-dione (PubChem CID 129431846) has the molecular formula C33H26N2O5 and a molecular weight of 530.58 g/mol. Its IUPAC name is (1R,2R,6S,7R)-4-[3-[(Z)-3-[3-[(1R,2R,6R,7R)-3,5-dioxo-4-azatricyclo[5.2.1.02,6]dec-8-en-4-yl]phenyl]-3-oxoprop-1-enyl]phenyl]-4-azatricyclo[5.2.1.02,6]dec-8-ene-3,5-dione.
| Compound Name | (1R,2R,6S,7R)-4-[3-[(Z)-3-[3-[(1R,2R,6R,7R)-3,5-dioxo-4-azatricyclo[5.2.1.02,6]dec-8-en-4-yl]phenyl]-3-oxoprop-1-enyl]phenyl]-4-azatricyclo[5.2.1.02,6]dec-8-ene-3,5-dione |
|---|---|
| PubChem CID | 129431846 |
| Molecular Formula | C33H26N2O5 |
| Molecular Weight | 530.58 g/mol |
| Exact Mass | 530.18 |
| IUPAC Name | (1R,2R,6S,7R)-4-[3-[(Z)-3-[3-[(1R,2R,6R,7R)-3,5-dioxo-4-azatricyclo[5.2.1.02,6]dec-8-en-4-yl]phenyl]-3-oxoprop-1-enyl]phenyl]-4-azatricyclo[5.2.1.02,6]dec-8-ene-3,5-dione |
| SMILES | O=C(/C=C\c1cccc(N2C(=O)[C@@H]3[C@H](C2=O)[C@H]2C=C[C@H]3C2)c1)c1cccc(N2C(=O)[C@H]3[C@H](C2=O)[C@H]2C=C[C@H]3C2)c1 |
| InChI | InChI=1S/C33H26N2O5/c36-25(18-4-2-6-24(16-18)35-32(39)28-21-10-11-22(15-21)29(28)33(35)40)12-7-17-3-1-5-23(13-17)34-30(37)26-19-8-9-20(14-19)27(26)31(34)38/h1-13,16,19-22,26-29H,14-15H2/b12-7-/t19-,20-,21-,22-,26-,27+,28+,29+/m0/s1 |
| InChIKey | YDAKZSBWASOUSU-YWFNPQAZSA-N |
| XLogP | 4.21 |
| TPSA | 91.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 530.58 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|