C25H24N2O4 — CID 55318819
[2-(cyclohexanecarbonylamino)-2-oxoethyl] 2-phenylquinoline-4-carboxylate (PubChem CID 55318819) has the molecular formula C25H24N2O4 and a molecular weight of 416.48 g/mol. Its IUPAC name is [2-(cyclohexanecarbonylamino)-2-oxoethyl] 2-phenylquinoline-4-carboxylate.
| Compound Name | [2-(cyclohexanecarbonylamino)-2-oxoethyl] 2-phenylquinoline-4-carboxylate |
|---|---|
| PubChem CID | 55318819 |
| Molecular Formula | C25H24N2O4 |
| Molecular Weight | 416.48 g/mol |
| Exact Mass | 416.17 |
| IUPAC Name | [2-(cyclohexanecarbonylamino)-2-oxoethyl] 2-phenylquinoline-4-carboxylate |
| SMILES | O=C(COC(=O)c1cc(-c2ccccc2)nc2ccccc12)NC(=O)C1CCCCC1 |
| InChI | InChI=1S/C25H24N2O4/c28-23(27-24(29)18-11-5-2-6-12-18)16-31-25(30)20-15-22(17-9-3-1-4-10-17)26-21-14-8-7-13-19(20)21/h1,3-4,7-10,13-15,18H,2,5-6,11-12,16H2,(H,27,28,29) |
| InChIKey | VKXQLQOPGHGXNL-UHFFFAOYSA-N |
| XLogP | 4.28 |
| TPSA | 85.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.48 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |