C35H32N2O6 — CID 98106393
[2-(3-methoxyphenyl)-2-oxoethyl] 2-[4-[(3aS,5S,7aR)-5-methyl-1,3-dioxo-3a,4,5,6,7,7a-hexahydroisoindol-2-yl]phenyl]-6-methylquinoline-4-carboxylate (PubChem CID 98106393) has the molecular formula C35H32N2O6 and a molecular weight of 576.65 g/mol. Its IUPAC name is [2-(3-methoxyphenyl)-2-oxoethyl] 2-[4-[(3aS,5S,7aR)-5-methyl-1,3-dioxo-3a,4,5,6,7,7a-hexahydroisoindol-2-yl]phenyl]-6-methylquinoline-4-carboxylate.
| Compound Name | [2-(3-methoxyphenyl)-2-oxoethyl] 2-[4-[(3aS,5S,7aR)-5-methyl-1,3-dioxo-3a,4,5,6,7,7a-hexahydroisoindol-2-yl]phenyl]-6-methylquinoline-4-carboxylate |
|---|---|
| PubChem CID | 98106393 |
| Molecular Formula | C35H32N2O6 |
| Molecular Weight | 576.65 g/mol |
| Exact Mass | 576.23 |
| IUPAC Name | [2-(3-methoxyphenyl)-2-oxoethyl] 2-[4-[(3aS,5S,7aR)-5-methyl-1,3-dioxo-3a,4,5,6,7,7a-hexahydroisoindol-2-yl]phenyl]-6-methylquinoline-4-carboxylate |
| SMILES | COc1cccc(C(=O)COC(=O)c2cc(-c3ccc(N4C(=O)[C@H]5C[C@@H](C)CC[C@H]5C4=O)cc3)nc3ccc(C)cc23)c1 |
| InChI | InChI=1S/C35H32N2O6/c1-20-7-13-26-28(16-20)34(40)37(33(26)39)24-11-9-22(10-12-24)31-18-29(27-15-21(2)8-14-30(27)36-31)35(41)43-19-32(38)23-5-4-6-25(17-23)42-3/h4-6,8-12,14-15,17-18,20,26,28H,7,13,16,19H2,1-3H3/t20-,26+,28-/m0/s1 |
| InChIKey | FWVAKWZDAJCFSB-GFNGZDJJSA-N |
| XLogP | 6.18 |
| TPSA | 102.87 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 576.65 |
| LogP ≤ 5 | 6.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|