C34H26Br2N2O6 — CID 3537106
[2-(3-methoxyphenyl)-2-oxoethyl] 2-[4-(8,9-dibromo-3,5-dioxo-4-azatricyclo[5.2.1.02,6]decan-4-yl)phenyl]quinoline-4-carboxylate (PubChem CID 3537106) has the molecular formula C34H26Br2N2O6 and a molecular weight of 718.40 g/mol. Its IUPAC name is [2-(3-methoxyphenyl)-2-oxoethyl] 2-[4-(8,9-dibromo-3,5-dioxo-4-azatricyclo[5.2.1.02,6]decan-4-yl)phenyl]quinoline-4-carboxylate.
| Compound Name | [2-(3-methoxyphenyl)-2-oxoethyl] 2-[4-(8,9-dibromo-3,5-dioxo-4-azatricyclo[5.2.1.02,6]decan-4-yl)phenyl]quinoline-4-carboxylate |
|---|---|
| PubChem CID | 3537106 |
| Molecular Formula | C34H26Br2N2O6 |
| Molecular Weight | 718.40 g/mol |
| Exact Mass | 716.02 |
| IUPAC Name | [2-(3-methoxyphenyl)-2-oxoethyl] 2-[4-(8,9-dibromo-3,5-dioxo-4-azatricyclo[5.2.1.02,6]decan-4-yl)phenyl]quinoline-4-carboxylate |
| SMILES | COc1cccc(C(=O)COC(=O)c2cc(-c3ccc(N4C(=O)C5C6CC(C(Br)C6Br)C5C4=O)cc3)nc3ccccc23)c1 |
| InChI | InChI=1S/C34H26Br2N2O6/c1-43-20-6-4-5-18(13-20)27(39)16-44-34(42)22-15-26(37-25-8-3-2-7-21(22)25)17-9-11-19(12-10-17)38-32(40)28-23-14-24(29(28)33(38)41)31(36)30(23)35/h2-13,15,23-24,28-31H,14,16H2,1H3 |
| InChIKey | WHHVPXCEWMHAQZ-UHFFFAOYSA-N |
| XLogP | 6.23 |
| TPSA | 102.87 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 718.40 |
| LogP ≤ 5 | 6.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|