C33H26BrN3O7 — CID 4294811
[2-(3-nitrophenyl)-2-oxoethyl] 6-bromo-2-[4-(5-methyl-1,3-dioxo-3a,4,5,6,7,7a-hexahydroisoindol-2-yl)phenyl]quinoline-4-carboxylate (PubChem CID 4294811) has the molecular formula C33H26BrN3O7 and a molecular weight of 656.49 g/mol. Its IUPAC name is [2-(3-nitrophenyl)-2-oxoethyl] 6-bromo-2-[4-(5-methyl-1,3-dioxo-3a,4,5,6,7,7a-hexahydroisoindol-2-yl)phenyl]quinoline-4-carboxylate.
| Compound Name | [2-(3-nitrophenyl)-2-oxoethyl] 6-bromo-2-[4-(5-methyl-1,3-dioxo-3a,4,5,6,7,7a-hexahydroisoindol-2-yl)phenyl]quinoline-4-carboxylate |
|---|---|
| PubChem CID | 4294811 |
| Molecular Formula | C33H26BrN3O7 |
| Molecular Weight | 656.49 g/mol |
| Exact Mass | 655.10 |
| IUPAC Name | [2-(3-nitrophenyl)-2-oxoethyl] 6-bromo-2-[4-(5-methyl-1,3-dioxo-3a,4,5,6,7,7a-hexahydroisoindol-2-yl)phenyl]quinoline-4-carboxylate |
| SMILES | CC1CCC2C(=O)N(c3ccc(-c4cc(C(=O)OCC(=O)c5cccc([N+](=O)[O-])c5)c5cc(Br)ccc5n4)cc3)C(=O)C2C1 |
| InChI | InChI=1S/C33H26BrN3O7/c1-18-5-11-24-26(13-18)32(40)36(31(24)39)22-9-6-19(7-10-22)29-16-27(25-15-21(34)8-12-28(25)35-29)33(41)44-17-30(38)20-3-2-4-23(14-20)37(42)43/h2-4,6-10,12,14-16,18,24,26H,5,11,13,17H2,1H3 |
| InChIKey | ZCESAZRNZFJEMA-UHFFFAOYSA-N |
| XLogP | 6.54 |
| TPSA | 136.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 656.49 |
| LogP ≤ 5 | 6.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|