C34H26BrN3O7 — CID 4990597
[2-(3-nitrophenyl)-2-oxoethyl] 6-bromo-2-[4-(3,5-dioxo-4-azatricyclo[5.2.1.02,6]decan-4-yl)phenyl]-8-methylquinoline-4-carboxylate (PubChem CID 4990597) has the molecular formula C34H26BrN3O7 and a molecular weight of 668.50 g/mol. Its IUPAC name is [2-(3-nitrophenyl)-2-oxoethyl] 6-bromo-2-[4-(3,5-dioxo-4-azatricyclo[5.2.1.02,6]decan-4-yl)phenyl]-8-methylquinoline-4-carboxylate.
| Compound Name | [2-(3-nitrophenyl)-2-oxoethyl] 6-bromo-2-[4-(3,5-dioxo-4-azatricyclo[5.2.1.02,6]decan-4-yl)phenyl]-8-methylquinoline-4-carboxylate |
|---|---|
| PubChem CID | 4990597 |
| Molecular Formula | C34H26BrN3O7 |
| Molecular Weight | 668.50 g/mol |
| Exact Mass | 667.10 |
| IUPAC Name | [2-(3-nitrophenyl)-2-oxoethyl] 6-bromo-2-[4-(3,5-dioxo-4-azatricyclo[5.2.1.02,6]decan-4-yl)phenyl]-8-methylquinoline-4-carboxylate |
| SMILES | Cc1cc(Br)cc2c(C(=O)OCC(=O)c3cccc([N+](=O)[O-])c3)cc(-c3ccc(N4C(=O)C5C6CCC(C6)C5C4=O)cc3)nc12 |
| InChI | InChI=1S/C34H26BrN3O7/c1-17-11-22(35)14-25-26(34(42)45-16-28(39)19-3-2-4-24(13-19)38(43)44)15-27(36-31(17)25)18-7-9-23(10-8-18)37-32(40)29-20-5-6-21(12-20)30(29)33(37)41/h2-4,7-11,13-15,20-21,29-30H,5-6,12,16H2,1H3 |
| InChIKey | CAWKTWIJIOEMDN-UHFFFAOYSA-N |
| XLogP | 6.46 |
| TPSA | 136.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 668.50 |
| LogP ≤ 5 | 6.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|