C34H28Cl2N2O5 — CID 4172615
[2-(2,4-dichlorophenyl)-2-oxoethyl] 6-methyl-2-[4-(5-methyl-1,3-dioxo-3a,4,5,6,7,7a-hexahydroisoindol-2-yl)phenyl]quinoline-4-carboxylate (PubChem CID 4172615) has the molecular formula C34H28Cl2N2O5 and a molecular weight of 615.51 g/mol. Its IUPAC name is [2-(2,4-dichlorophenyl)-2-oxoethyl] 6-methyl-2-[4-(5-methyl-1,3-dioxo-3a,4,5,6,7,7a-hexahydroisoindol-2-yl)phenyl]quinoline-4-carboxylate.
| Compound Name | [2-(2,4-dichlorophenyl)-2-oxoethyl] 6-methyl-2-[4-(5-methyl-1,3-dioxo-3a,4,5,6,7,7a-hexahydroisoindol-2-yl)phenyl]quinoline-4-carboxylate |
|---|---|
| PubChem CID | 4172615 |
| Molecular Formula | C34H28Cl2N2O5 |
| Molecular Weight | 615.51 g/mol |
| Exact Mass | 614.14 |
| IUPAC Name | [2-(2,4-dichlorophenyl)-2-oxoethyl] 6-methyl-2-[4-(5-methyl-1,3-dioxo-3a,4,5,6,7,7a-hexahydroisoindol-2-yl)phenyl]quinoline-4-carboxylate |
| SMILES | Cc1ccc2nc(-c3ccc(N4C(=O)C5CCC(C)CC5C4=O)cc3)cc(C(=O)OCC(=O)c3ccc(Cl)cc3Cl)c2c1 |
| InChI | InChI=1S/C34H28Cl2N2O5/c1-18-3-10-23-26(14-18)33(41)38(32(23)40)22-8-5-20(6-9-22)30-16-27(25-13-19(2)4-12-29(25)37-30)34(42)43-17-31(39)24-11-7-21(35)15-28(24)36/h4-9,11-13,15-16,18,23,26H,3,10,14,17H2,1-2H3 |
| InChIKey | VGEYEZLBOFPFQK-UHFFFAOYSA-N |
| XLogP | 7.48 |
| TPSA | 93.64 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 615.51 |
| LogP ≤ 5 | 7.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|