C35H31ClN2O5 — CID 5065634
[1-(4-methylphenyl)-1-oxopropan-2-yl] 6-chloro-2-[4-(5-methyl-1,3-dioxo-3a,4,5,6,7,7a-hexahydroisoindol-2-yl)phenyl]quinoline-4-carboxylate (PubChem CID 5065634) has the molecular formula C35H31ClN2O5 and a molecular weight of 595.10 g/mol. Its IUPAC name is [1-(4-methylphenyl)-1-oxopropan-2-yl] 6-chloro-2-[4-(5-methyl-1,3-dioxo-3a,4,5,6,7,7a-hexahydroisoindol-2-yl)phenyl]quinoline-4-carboxylate.
| Compound Name | [1-(4-methylphenyl)-1-oxopropan-2-yl] 6-chloro-2-[4-(5-methyl-1,3-dioxo-3a,4,5,6,7,7a-hexahydroisoindol-2-yl)phenyl]quinoline-4-carboxylate |
|---|---|
| PubChem CID | 5065634 |
| Molecular Formula | C35H31ClN2O5 |
| Molecular Weight | 595.10 g/mol |
| Exact Mass | 594.19 |
| IUPAC Name | [1-(4-methylphenyl)-1-oxopropan-2-yl] 6-chloro-2-[4-(5-methyl-1,3-dioxo-3a,4,5,6,7,7a-hexahydroisoindol-2-yl)phenyl]quinoline-4-carboxylate |
| SMILES | Cc1ccc(C(=O)C(C)OC(=O)c2cc(-c3ccc(N4C(=O)C5CCC(C)CC5C4=O)cc3)nc3ccc(Cl)cc23)cc1 |
| InChI | InChI=1S/C35H31ClN2O5/c1-19-4-7-23(8-5-19)32(39)21(3)43-35(42)29-18-31(37-30-15-11-24(36)17-27(29)30)22-9-12-25(13-10-22)38-33(40)26-14-6-20(2)16-28(26)34(38)41/h4-5,7-13,15,17-18,20-21,26,28H,6,14,16H2,1-3H3 |
| InChIKey | SDYNKUYEFVWUHH-UHFFFAOYSA-N |
| XLogP | 7.22 |
| TPSA | 93.64 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 595.10 |
| LogP ≤ 5 | 7.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|