C23H20N2O7S — CID 16519120
[2-[(2-methoxydibenzofuran-3-yl)amino]-2-oxoethyl] 2-(methanesulfonamido)benzoate (PubChem CID 16519120) has the molecular formula C23H20N2O7S and a molecular weight of 468.49 g/mol. Its IUPAC name is [2-[(2-methoxydibenzofuran-3-yl)amino]-2-oxoethyl] 2-(methanesulfonamido)benzoate.
| Compound Name | [2-[(2-methoxydibenzofuran-3-yl)amino]-2-oxoethyl] 2-(methanesulfonamido)benzoate |
|---|---|
| PubChem CID | 16519120 |
| Molecular Formula | C23H20N2O7S |
| Molecular Weight | 468.49 g/mol |
| Exact Mass | 468.10 |
| IUPAC Name | [2-[(2-methoxydibenzofuran-3-yl)amino]-2-oxoethyl] 2-(methanesulfonamido)benzoate |
| SMILES | COc1cc2c(cc1NC(=O)COC(=O)c1ccccc1NS(C)(=O)=O)oc1ccccc12 |
| InChI | InChI=1S/C23H20N2O7S/c1-30-21-11-16-14-7-4-6-10-19(14)32-20(16)12-18(21)24-22(26)13-31-23(27)15-8-3-5-9-17(15)25-33(2,28)29/h3-12,25H,13H2,1-2H3,(H,24,26) |
| InChIKey | NFKZZETUYJMWHO-UHFFFAOYSA-N |
| XLogP | 3.76 |
| TPSA | 123.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.49 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |