C17H19N3O5S — CID 71895973
1-[2-(methanesulfonamido)ethyl]-3-(2-methoxydibenzofuran-3-yl)urea (PubChem CID 71895973) has the molecular formula C17H19N3O5S and a molecular weight of 377.42 g/mol. Its IUPAC name is 1-[2-(methanesulfonamido)ethyl]-3-(2-methoxydibenzofuran-3-yl)urea.
| Compound Name | 1-[2-(methanesulfonamido)ethyl]-3-(2-methoxydibenzofuran-3-yl)urea |
|---|---|
| PubChem CID | 71895973 |
| Molecular Formula | C17H19N3O5S |
| Molecular Weight | 377.42 g/mol |
| Exact Mass | 377.10 |
| IUPAC Name | 1-[2-(methanesulfonamido)ethyl]-3-(2-methoxydibenzofuran-3-yl)urea |
| SMILES | COc1cc2c(cc1NC(=O)NCCNS(C)(=O)=O)oc1ccccc12 |
| InChI | InChI=1S/C17H19N3O5S/c1-24-16-9-12-11-5-3-4-6-14(11)25-15(12)10-13(16)20-17(21)18-7-8-19-26(2,22)23/h3-6,9-10,19H,7-8H2,1-2H3,(H2,18,20,21) |
| InChIKey | OMLKAMXTPOHPGJ-UHFFFAOYSA-N |
| XLogP | 2.27 |
| TPSA | 109.67 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.42 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|