C22H20N2O4 — CID 72686859
1-(2-hydroxy-1-phenylethyl)-3-(2-methoxydibenzofuran-3-yl)urea (PubChem CID 72686859) has the molecular formula C22H20N2O4 and a molecular weight of 376.41 g/mol. Its IUPAC name is 1-(2-hydroxy-1-phenylethyl)-3-(2-methoxydibenzofuran-3-yl)urea.
| Compound Name | 1-(2-hydroxy-1-phenylethyl)-3-(2-methoxydibenzofuran-3-yl)urea |
|---|---|
| PubChem CID | 72686859 |
| Molecular Formula | C22H20N2O4 |
| Molecular Weight | 376.41 g/mol |
| Exact Mass | 376.14 |
| IUPAC Name | 1-(2-hydroxy-1-phenylethyl)-3-(2-methoxydibenzofuran-3-yl)urea |
| SMILES | COc1cc2c(cc1NC(=O)NC(CO)c1ccccc1)oc1ccccc12 |
| InChI | InChI=1S/C22H20N2O4/c1-27-21-11-16-15-9-5-6-10-19(15)28-20(16)12-17(21)23-22(26)24-18(13-25)14-7-3-2-4-8-14/h2-12,18,25H,13H2,1H3,(H2,23,24,26) |
| InChIKey | DQMGTDQNVHGQMS-UHFFFAOYSA-N |
| XLogP | 4.45 |
| TPSA | 83.73 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.41 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |