C23H23N2O3+ — CID 2684318
[2-[(2-methoxydibenzofuran-3-yl)amino]-2-oxoethyl]-[(1R)-1-phenylethyl]azanium (PubChem CID 2684318) has the molecular formula C23H23N2O3+ and a molecular weight of 375.45 g/mol. Its IUPAC name is [2-[(2-methoxydibenzofuran-3-yl)amino]-2-oxoethyl]-[(1R)-1-phenylethyl]azanium.
| Compound Name | [2-[(2-methoxydibenzofuran-3-yl)amino]-2-oxoethyl]-[(1R)-1-phenylethyl]azanium |
|---|---|
| PubChem CID | 2684318 |
| Molecular Formula | C23H23N2O3+ |
| Molecular Weight | 375.45 g/mol |
| Exact Mass | 375.17 |
| IUPAC Name | [2-[(2-methoxydibenzofuran-3-yl)amino]-2-oxoethyl]-[(1R)-1-phenylethyl]azanium |
| SMILES | COc1cc2c(cc1NC(=O)C[NH2+][C@H](C)c1ccccc1)oc1ccccc12 |
| InChI | InChI=1S/C23H22N2O3/c1-15(16-8-4-3-5-9-16)24-14-23(26)25-19-13-21-18(12-22(19)27-2)17-10-6-7-11-20(17)28-21/h3-13,15,24H,14H2,1-2H3,(H,25,26)/p+1/t15-/m1/s1 |
| InChIKey | XEQYLTQNORFNGB-OAHLLOKOSA-O |
| XLogP | 3.86 |
| TPSA | 68.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.45 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |