C26H26N2O5 — CID 2078838
[2-[(2-methoxydibenzofuran-3-yl)amino]-2-oxoethyl] 4-(diethylamino)benzoate (PubChem CID 2078838) has the molecular formula C26H26N2O5 and a molecular weight of 446.50 g/mol. Its IUPAC name is [2-[(2-methoxydibenzofuran-3-yl)amino]-2-oxoethyl] 4-(diethylamino)benzoate.
| Compound Name | [2-[(2-methoxydibenzofuran-3-yl)amino]-2-oxoethyl] 4-(diethylamino)benzoate |
|---|---|
| PubChem CID | 2078838 |
| Molecular Formula | C26H26N2O5 |
| Molecular Weight | 446.50 g/mol |
| Exact Mass | 446.18 |
| IUPAC Name | [2-[(2-methoxydibenzofuran-3-yl)amino]-2-oxoethyl] 4-(diethylamino)benzoate |
| SMILES | CCN(CC)c1ccc(C(=O)OCC(=O)Nc2cc3oc4ccccc4c3cc2OC)cc1 |
| InChI | InChI=1S/C26H26N2O5/c1-4-28(5-2)18-12-10-17(11-13-18)26(30)32-16-25(29)27-21-15-23-20(14-24(21)31-3)19-8-6-7-9-22(19)33-23/h6-15H,4-5,16H2,1-3H3,(H,27,29) |
| InChIKey | DNJMPLYTQJTDTK-UHFFFAOYSA-N |
| XLogP | 5.24 |
| TPSA | 81.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.50 |
| LogP ≤ 5 | 5.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |