C21H17BrN4O5 — CID 55485291
[2-(2-bromo-4-nitroanilino)-2-oxoethyl] 1-phenyl-5,6-dihydro-4H-cyclopenta[d]pyrazole-3-carboxylate (PubChem CID 55485291) has the molecular formula C21H17BrN4O5 and a molecular weight of 485.29 g/mol. Its IUPAC name is [2-(2-bromo-4-nitroanilino)-2-oxoethyl] 1-phenyl-5,6-dihydro-4H-cyclopenta[d]pyrazole-3-carboxylate.
| Compound Name | [2-(2-bromo-4-nitroanilino)-2-oxoethyl] 1-phenyl-5,6-dihydro-4H-cyclopenta[d]pyrazole-3-carboxylate |
|---|---|
| PubChem CID | 55485291 |
| Molecular Formula | C21H17BrN4O5 |
| Molecular Weight | 485.29 g/mol |
| Exact Mass | 484.04 |
| IUPAC Name | [2-(2-bromo-4-nitroanilino)-2-oxoethyl] 1-phenyl-5,6-dihydro-4H-cyclopenta[d]pyrazole-3-carboxylate |
| SMILES | O=C(COC(=O)c1nn(-c2ccccc2)c2c1CCC2)Nc1ccc([N+](=O)[O-])cc1Br |
| InChI | InChI=1S/C21H17BrN4O5/c22-16-11-14(26(29)30)9-10-17(16)23-19(27)12-31-21(28)20-15-7-4-8-18(15)25(24-20)13-5-2-1-3-6-13/h1-3,5-6,9-11H,4,7-8,12H2,(H,23,27) |
| InChIKey | SHLLDOPYEPIXCC-UHFFFAOYSA-N |
| XLogP | 3.83 |
| TPSA | 116.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.29 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|