C22H19FN4O5 — CID 30178402
[2-(2-nitroanilino)-2-oxoethyl] 1-(4-fluorophenyl)-4,5,6,7-tetrahydroindazole-3-carboxylate (PubChem CID 30178402) has the molecular formula C22H19FN4O5 and a molecular weight of 438.42 g/mol. Its IUPAC name is [2-(2-nitroanilino)-2-oxoethyl] 1-(4-fluorophenyl)-4,5,6,7-tetrahydroindazole-3-carboxylate.
| Compound Name | [2-(2-nitroanilino)-2-oxoethyl] 1-(4-fluorophenyl)-4,5,6,7-tetrahydroindazole-3-carboxylate |
|---|---|
| PubChem CID | 30178402 |
| Molecular Formula | C22H19FN4O5 |
| Molecular Weight | 438.42 g/mol |
| Exact Mass | 438.13 |
| IUPAC Name | [2-(2-nitroanilino)-2-oxoethyl] 1-(4-fluorophenyl)-4,5,6,7-tetrahydroindazole-3-carboxylate |
| SMILES | O=C(COC(=O)c1nn(-c2ccc(F)cc2)c2c1CCCC2)Nc1ccccc1[N+](=O)[O-] |
| InChI | InChI=1S/C22H19FN4O5/c23-14-9-11-15(12-10-14)26-18-7-3-1-5-16(18)21(25-26)22(29)32-13-20(28)24-17-6-2-4-8-19(17)27(30)31/h2,4,6,8-12H,1,3,5,7,13H2,(H,24,28) |
| InChIKey | WIGOADYXVWJIKD-UHFFFAOYSA-N |
| XLogP | 3.59 |
| TPSA | 116.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.42 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|