C22H19FN4O6 — CID 46694041
[2-(4-methoxy-2-nitroanilino)-2-oxoethyl] 1-(4-fluorophenyl)-5,6-dihydro-4H-cyclopenta[d]pyrazole-3-carboxylate (PubChem CID 46694041) has the molecular formula C22H19FN4O6 and a molecular weight of 454.41 g/mol. Its IUPAC name is [2-(4-methoxy-2-nitroanilino)-2-oxoethyl] 1-(4-fluorophenyl)-5,6-dihydro-4H-cyclopenta[d]pyrazole-3-carboxylate.
| Compound Name | [2-(4-methoxy-2-nitroanilino)-2-oxoethyl] 1-(4-fluorophenyl)-5,6-dihydro-4H-cyclopenta[d]pyrazole-3-carboxylate |
|---|---|
| PubChem CID | 46694041 |
| Molecular Formula | C22H19FN4O6 |
| Molecular Weight | 454.41 g/mol |
| Exact Mass | 454.13 |
| IUPAC Name | [2-(4-methoxy-2-nitroanilino)-2-oxoethyl] 1-(4-fluorophenyl)-5,6-dihydro-4H-cyclopenta[d]pyrazole-3-carboxylate |
| SMILES | COc1ccc(NC(=O)COC(=O)c2nn(-c3ccc(F)cc3)c3c2CCC3)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C22H19FN4O6/c1-32-15-9-10-17(19(11-15)27(30)31)24-20(28)12-33-22(29)21-16-3-2-4-18(16)26(25-21)14-7-5-13(23)6-8-14/h5-11H,2-4,12H2,1H3,(H,24,28) |
| InChIKey | AEVGETTZHKAQJT-UHFFFAOYSA-N |
| XLogP | 3.21 |
| TPSA | 125.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.41 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|