C19H16ClN5O5 — CID 55517290
[1-(2-chloro-5-nitroanilino)-1-oxopropan-2-yl] 1-benzyltriazole-4-carboxylate (PubChem CID 55517290) has the molecular formula C19H16ClN5O5 and a molecular weight of 429.82 g/mol. Its IUPAC name is [1-(2-chloro-5-nitroanilino)-1-oxopropan-2-yl] 1-benzyltriazole-4-carboxylate.
| Compound Name | [1-(2-chloro-5-nitroanilino)-1-oxopropan-2-yl] 1-benzyltriazole-4-carboxylate |
|---|---|
| PubChem CID | 55517290 |
| Molecular Formula | C19H16ClN5O5 |
| Molecular Weight | 429.82 g/mol |
| Exact Mass | 429.08 |
| IUPAC Name | [1-(2-chloro-5-nitroanilino)-1-oxopropan-2-yl] 1-benzyltriazole-4-carboxylate |
| SMILES | CC(OC(=O)c1cn(Cc2ccccc2)nn1)C(=O)Nc1cc([N+](=O)[O-])ccc1Cl |
| InChI | InChI=1S/C19H16ClN5O5/c1-12(18(26)21-16-9-14(25(28)29)7-8-15(16)20)30-19(27)17-11-24(23-22-17)10-13-5-3-2-4-6-13/h2-9,11-12H,10H2,1H3,(H,21,26) |
| InChIKey | UJUGANUGWCQSCZ-UHFFFAOYSA-N |
| XLogP | 3.07 |
| TPSA | 129.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.82 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|