C21H17ClN4O6 — CID 5114611
[1-(2-chloro-5-nitroanilino)-1-oxopropan-2-yl] 1-benzyl-6-oxopyridazine-3-carboxylate (PubChem CID 5114611) has the molecular formula C21H17ClN4O6 and a molecular weight of 456.84 g/mol. Its IUPAC name is [1-(2-chloro-5-nitroanilino)-1-oxopropan-2-yl] 1-benzyl-6-oxopyridazine-3-carboxylate.
| Compound Name | [1-(2-chloro-5-nitroanilino)-1-oxopropan-2-yl] 1-benzyl-6-oxopyridazine-3-carboxylate |
|---|---|
| PubChem CID | 5114611 |
| Molecular Formula | C21H17ClN4O6 |
| Molecular Weight | 456.84 g/mol |
| Exact Mass | 456.08 |
| IUPAC Name | [1-(2-chloro-5-nitroanilino)-1-oxopropan-2-yl] 1-benzyl-6-oxopyridazine-3-carboxylate |
| SMILES | CC(OC(=O)c1ccc(=O)n(Cc2ccccc2)n1)C(=O)Nc1cc([N+](=O)[O-])ccc1Cl |
| InChI | InChI=1S/C21H17ClN4O6/c1-13(20(28)23-18-11-15(26(30)31)7-8-16(18)22)32-21(29)17-9-10-19(27)25(24-17)12-14-5-3-2-4-6-14/h2-11,13H,12H2,1H3,(H,23,28) |
| InChIKey | DKRAEHZCNDXAOM-UHFFFAOYSA-N |
| XLogP | 3.04 |
| TPSA | 133.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.84 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|