C19H13N5O3S — CID 177330820
N-[2-amino-4-(3-nitrophenyl)-3-pyridinyl]-1,3-benzothiazole-6-carboxamide (PubChem CID 177330820) has the molecular formula C19H13N5O3S and a molecular weight of 391.41 g/mol. Its IUPAC name is N-[2-amino-4-(3-nitrophenyl)-3-pyridinyl]-1,3-benzothiazole-6-carboxamide.
| Compound Name | N-[2-amino-4-(3-nitrophenyl)-3-pyridinyl]-1,3-benzothiazole-6-carboxamide |
|---|---|
| PubChem CID | 177330820 |
| Molecular Formula | C19H13N5O3S |
| Molecular Weight | 391.41 g/mol |
| Exact Mass | 391.07 |
| IUPAC Name | N-[2-amino-4-(3-nitrophenyl)-3-pyridinyl]-1,3-benzothiazole-6-carboxamide |
| SMILES | Nc1nccc(-c2cccc([N+](=O)[O-])c2)c1NC(=O)c1ccc2ncsc2c1 |
| InChI | InChI=1S/C19H13N5O3S/c20-18-17(23-19(25)12-4-5-15-16(9-12)28-10-22-15)14(6-7-21-18)11-2-1-3-13(8-11)24(26)27/h1-10H,(H2,20,21)(H,23,25) |
| InChIKey | ULLBWOVTJAWKQM-UHFFFAOYSA-N |
| XLogP | 4.10 |
| TPSA | 124.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.41 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|