C19H20FN5O6 — CID 59053633
1-(2,4-dinitroanilino)-3-[4-(4-fluorophenoxy)cyclohexyl]urea (PubChem CID 59053633) has the molecular formula C19H20FN5O6 and a molecular weight of 433.40 g/mol. Its IUPAC name is 1-(2,4-dinitroanilino)-3-[4-(4-fluorophenoxy)cyclohexyl]urea.
| Compound Name | 1-(2,4-dinitroanilino)-3-[4-(4-fluorophenoxy)cyclohexyl]urea |
|---|---|
| PubChem CID | 59053633 |
| Molecular Formula | C19H20FN5O6 |
| Molecular Weight | 433.40 g/mol |
| Exact Mass | 433.14 |
| IUPAC Name | 1-(2,4-dinitroanilino)-3-[4-(4-fluorophenoxy)cyclohexyl]urea |
| SMILES | O=C(NNc1ccc([N+](=O)[O-])cc1[N+](=O)[O-])NC1CCC(Oc2ccc(F)cc2)CC1 |
| InChI | InChI=1S/C19H20FN5O6/c20-12-1-6-15(7-2-12)31-16-8-3-13(4-9-16)21-19(26)23-22-17-10-5-14(24(27)28)11-18(17)25(29)30/h1-2,5-7,10-11,13,16,22H,3-4,8-9H2,(H2,21,23,26) |
| InChIKey | AEPQHHDMDVFRET-UHFFFAOYSA-N |
| XLogP | 3.66 |
| TPSA | 148.67 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.40 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|