C11H13N5O7S — CID 3844437
1-(2,4-dinitroanilino)-3-(1,1-dioxothiolan-3-yl)urea (PubChem CID 3844437) has the molecular formula C11H13N5O7S and a molecular weight of 359.32 g/mol. Its IUPAC name is 1-(2,4-dinitroanilino)-3-(1,1-dioxothiolan-3-yl)urea.
| Compound Name | 1-(2,4-dinitroanilino)-3-(1,1-dioxothiolan-3-yl)urea |
|---|---|
| PubChem CID | 3844437 |
| Molecular Formula | C11H13N5O7S |
| Molecular Weight | 359.32 g/mol |
| Exact Mass | 359.05 |
| IUPAC Name | 1-(2,4-dinitroanilino)-3-(1,1-dioxothiolan-3-yl)urea |
| SMILES | O=C(NNc1ccc([N+](=O)[O-])cc1[N+](=O)[O-])NC1CCS(=O)(=O)C1 |
| InChI | InChI=1S/C11H13N5O7S/c17-11(12-7-3-4-24(22,23)6-7)14-13-9-2-1-8(15(18)19)5-10(9)16(20)21/h1-2,5,7,13H,3-4,6H2,(H2,12,14,17) |
| InChIKey | JDNVVAONMWPXKQ-UHFFFAOYSA-N |
| XLogP | 0.32 |
| TPSA | 173.58 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.32 |
| LogP ≤ 5 | 0.32 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|