C22H26N10O10 — CID 56639891
1-(2,4-dinitroanilino)-3-[[3-[[(2,4-dinitroanilino)carbamoylamino]methyl]cyclohexyl]methyl]urea (PubChem CID 56639891) has the molecular formula C22H26N10O10 and a molecular weight of 590.51 g/mol. Its IUPAC name is 1-(2,4-dinitroanilino)-3-[[3-[[(2,4-dinitroanilino)carbamoylamino]methyl]cyclohexyl]methyl]urea.
| Compound Name | 1-(2,4-dinitroanilino)-3-[[3-[[(2,4-dinitroanilino)carbamoylamino]methyl]cyclohexyl]methyl]urea |
|---|---|
| PubChem CID | 56639891 |
| Molecular Formula | C22H26N10O10 |
| Molecular Weight | 590.51 g/mol |
| Exact Mass | 590.18 |
| IUPAC Name | 1-(2,4-dinitroanilino)-3-[[3-[[(2,4-dinitroanilino)carbamoylamino]methyl]cyclohexyl]methyl]urea |
| SMILES | O=C(NCC1CCCC(CNC(=O)NNc2ccc([N+](=O)[O-])cc2[N+](=O)[O-])C1)NNc1ccc([N+](=O)[O-])cc1[N+](=O)[O-] |
| InChI | InChI=1S/C22H26N10O10/c33-21(27-25-17-6-4-15(29(35)36)9-19(17)31(39)40)23-11-13-2-1-3-14(8-13)12-24-22(34)28-26-18-7-5-16(30(37)38)10-20(18)32(41)42/h4-7,9-10,13-14,25-26H,1-3,8,11-12H2,(H2,23,27,33)(H2,24,28,34) |
| InChIKey | XPTGGTQEZIFXRJ-UHFFFAOYSA-N |
| XLogP | 3.08 |
| TPSA | 278.88 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 42 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 590.51 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|