C11H14N4O5S — CID 62235008
N-(1,1-dioxothiolan-3-yl)-4-hydrazinyl-3-nitrobenzamide (PubChem CID 62235008) has the molecular formula C11H14N4O5S and a molecular weight of 314.32 g/mol. Its IUPAC name is N-(1,1-dioxothiolan-3-yl)-4-hydrazinyl-3-nitrobenzamide.
| Compound Name | N-(1,1-dioxothiolan-3-yl)-4-hydrazinyl-3-nitrobenzamide |
|---|---|
| PubChem CID | 62235008 |
| Molecular Formula | C11H14N4O5S |
| Molecular Weight | 314.32 g/mol |
| Exact Mass | 314.07 |
| IUPAC Name | N-(1,1-dioxothiolan-3-yl)-4-hydrazinyl-3-nitrobenzamide |
| SMILES | NNc1ccc(C(=O)NC2CCS(=O)(=O)C2)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C11H14N4O5S/c12-14-9-2-1-7(5-10(9)15(17)18)11(16)13-8-3-4-21(19,20)6-8/h1-2,5,8,14H,3-4,6,12H2,(H,13,16) |
| InChIKey | RSDYRZAHLWPBCH-UHFFFAOYSA-N |
| XLogP | -0.20 |
| TPSA | 144.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.32 |
| LogP ≤ 5 | -0.20 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|