C11H12N2O6S — CID 82784084
3-[(1,1-dioxothiolan-3-yl)amino]-4-nitrobenzoic acid (PubChem CID 82784084) has the molecular formula C11H12N2O6S and a molecular weight of 300.29 g/mol. Its IUPAC name is 3-[(1,1-dioxothiolan-3-yl)amino]-4-nitrobenzoic acid.
| Compound Name | 3-[(1,1-dioxothiolan-3-yl)amino]-4-nitrobenzoic acid |
|---|---|
| PubChem CID | 82784084 |
| Molecular Formula | C11H12N2O6S |
| Molecular Weight | 300.29 g/mol |
| Exact Mass | 300.04 |
| IUPAC Name | 3-[(1,1-dioxothiolan-3-yl)amino]-4-nitrobenzoic acid |
| SMILES | O=C(O)c1ccc([N+](=O)[O-])c(NC2CCS(=O)(=O)C2)c1 |
| InChI | InChI=1S/C11H12N2O6S/c14-11(15)7-1-2-10(13(16)17)9(5-7)12-8-3-4-20(18,19)6-8/h1-2,5,8,12H,3-4,6H2,(H,14,15) |
| InChIKey | LUOQDBYCRQZPJD-UHFFFAOYSA-N |
| XLogP | 0.89 |
| TPSA | 126.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.29 |
| LogP ≤ 5 | 0.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|