C15H21N3O6S2 — CID 41213852
(3R)-N-(2-nitro-4-piperidin-1-ylsulfonylphenyl)-1,1-dioxothiolan-3-amine (PubChem CID 41213852) has the molecular formula C15H21N3O6S2 and a molecular weight of 403.48 g/mol. Its IUPAC name is (3R)-N-(2-nitro-4-piperidin-1-ylsulfonylphenyl)-1,1-dioxothiolan-3-amine.
| Compound Name | (3R)-N-(2-nitro-4-piperidin-1-ylsulfonylphenyl)-1,1-dioxothiolan-3-amine |
|---|---|
| PubChem CID | 41213852 |
| Molecular Formula | C15H21N3O6S2 |
| Molecular Weight | 403.48 g/mol |
| Exact Mass | 403.09 |
| IUPAC Name | (3R)-N-(2-nitro-4-piperidin-1-ylsulfonylphenyl)-1,1-dioxothiolan-3-amine |
| SMILES | O=[N+]([O-])c1cc(S(=O)(=O)N2CCCCC2)ccc1N[C@@H]1CCS(=O)(=O)C1 |
| InChI | InChI=1S/C15H21N3O6S2/c19-18(20)15-10-13(26(23,24)17-7-2-1-3-8-17)4-5-14(15)16-12-6-9-25(21,22)11-12/h4-5,10,12,16H,1-3,6-9,11H2/t12-/m1/s1 |
| InChIKey | SDRYZIIIHHRCEI-GFCCVEGCSA-N |
| XLogP | 1.37 |
| TPSA | 126.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.48 |
| LogP ≤ 5 | 1.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|