C25H35N3O4 — CID 176882006
1-(3,5-dimethyl-1-adamantyl)-3-[4-(4-nitrophenoxy)cyclohexyl]urea (PubChem CID 176882006) has the molecular formula C25H35N3O4 and a molecular weight of 441.57 g/mol. Its IUPAC name is 1-(3,5-dimethyl-1-adamantyl)-3-[4-(4-nitrophenoxy)cyclohexyl]urea.
| Compound Name | 1-(3,5-dimethyl-1-adamantyl)-3-[4-(4-nitrophenoxy)cyclohexyl]urea |
|---|---|
| PubChem CID | 176882006 |
| Molecular Formula | C25H35N3O4 |
| Molecular Weight | 441.57 g/mol |
| Exact Mass | 441.26 |
| IUPAC Name | 1-(3,5-dimethyl-1-adamantyl)-3-[4-(4-nitrophenoxy)cyclohexyl]urea |
| SMILES | CC12CC3CC(C)(C1)CC(NC(=O)NC1CCC(Oc4ccc([N+](=O)[O-])cc4)CC1)(C3)C2 |
| InChI | InChI=1S/C25H35N3O4/c1-23-11-17-12-24(2,14-23)16-25(13-17,15-23)27-22(29)26-18-3-7-20(8-4-18)32-21-9-5-19(6-10-21)28(30)31/h5-6,9-10,17-18,20H,3-4,7-8,11-16H2,1-2H3,(H2,26,27,29) |
| InChIKey | DHLAJFILIUYVOT-UHFFFAOYSA-N |
| XLogP | 5.33 |
| TPSA | 93.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.57 |
| LogP ≤ 5 | 5.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|