C21H28N2O4 — CID 98182397
N-[(3S,5S)-3,5-dimethyl-1-adamantyl]-4-ethoxy-3-nitrobenzamide (PubChem CID 98182397) has the molecular formula C21H28N2O4 and a molecular weight of 372.47 g/mol. Its IUPAC name is N-[(3S,5S)-3,5-dimethyl-1-adamantyl]-4-ethoxy-3-nitrobenzamide.
| Compound Name | N-[(3S,5S)-3,5-dimethyl-1-adamantyl]-4-ethoxy-3-nitrobenzamide |
|---|---|
| PubChem CID | 98182397 |
| Molecular Formula | C21H28N2O4 |
| Molecular Weight | 372.47 g/mol |
| Exact Mass | 372.20 |
| IUPAC Name | N-[(3S,5S)-3,5-dimethyl-1-adamantyl]-4-ethoxy-3-nitrobenzamide |
| SMILES | CCOc1ccc(C(=O)NC23CC4C[C@](C)(C2)C[C@](C)(C4)C3)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C21H28N2O4/c1-4-27-17-6-5-15(7-16(17)23(25)26)18(24)22-21-10-14-8-19(2,12-21)11-20(3,9-14)13-21/h5-7,14H,4,8-13H2,1-3H3,(H,22,24)/t14?,19-,20-,21?/m0/s1 |
| InChIKey | HQYKQJRAIWISQQ-FMXWSCRGSA-N |
| XLogP | 4.47 |
| TPSA | 81.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.47 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|