C24H35N4O3+ — CID 7319845
N-[(3S,5R)-3,5-dimethyl-1-adamantyl]-4-(4-methylpiperazin-4-ium-1-yl)-3-nitrobenzamide (PubChem CID 7319845) has the molecular formula C24H35N4O3+ and a molecular weight of 427.57 g/mol. Its IUPAC name is N-[(3S,5R)-3,5-dimethyl-1-adamantyl]-4-(4-methylpiperazin-4-ium-1-yl)-3-nitrobenzamide.
| Compound Name | N-[(3S,5R)-3,5-dimethyl-1-adamantyl]-4-(4-methylpiperazin-4-ium-1-yl)-3-nitrobenzamide |
|---|---|
| PubChem CID | 7319845 |
| Molecular Formula | C24H35N4O3+ |
| Molecular Weight | 427.57 g/mol |
| Exact Mass | 427.27 |
| IUPAC Name | N-[(3S,5R)-3,5-dimethyl-1-adamantyl]-4-(4-methylpiperazin-4-ium-1-yl)-3-nitrobenzamide |
| SMILES | C[NH+]1CCN(c2ccc(C(=O)NC34CC5C[C@@](C)(C3)C[C@](C)(C5)C4)cc2[N+](=O)[O-])CC1 |
| InChI | InChI=1S/C24H34N4O3/c1-22-11-17-12-23(2,14-22)16-24(13-17,15-22)25-21(29)18-4-5-19(20(10-18)28(30)31)27-8-6-26(3)7-9-27/h4-5,10,17H,6-9,11-16H2,1-3H3,(H,25,29)/p+1/t17?,22-,23+,24? |
| InChIKey | USSACIZHIQBDOP-MDQWUCQQSA-O |
| XLogP | 2.41 |
| TPSA | 79.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.57 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|