C26H30N4O5 — CID 17285750
N-(1-adamantyl)-4-[4-(furan-2-carbonyl)piperazin-1-yl]-3-nitrobenzamide (PubChem CID 17285750) has the molecular formula C26H30N4O5 and a molecular weight of 478.55 g/mol. Its IUPAC name is N-(1-adamantyl)-4-[4-(furan-2-carbonyl)piperazin-1-yl]-3-nitrobenzamide.
| Compound Name | N-(1-adamantyl)-4-[4-(furan-2-carbonyl)piperazin-1-yl]-3-nitrobenzamide |
|---|---|
| PubChem CID | 17285750 |
| Molecular Formula | C26H30N4O5 |
| Molecular Weight | 478.55 g/mol |
| Exact Mass | 478.22 |
| IUPAC Name | N-(1-adamantyl)-4-[4-(furan-2-carbonyl)piperazin-1-yl]-3-nitrobenzamide |
| SMILES | O=C(NC12CC3CC(CC(C3)C1)C2)c1ccc(N2CCN(C(=O)c3ccco3)CC2)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C26H30N4O5/c31-24(27-26-14-17-10-18(15-26)12-19(11-17)16-26)20-3-4-21(22(13-20)30(33)34)28-5-7-29(8-6-28)25(32)23-2-1-9-35-23/h1-4,9,13,17-19H,5-8,10-12,14-16H2,(H,27,31) |
| InChIKey | YHYMXOZNVPSXRM-UHFFFAOYSA-N |
| XLogP | 3.85 |
| TPSA | 108.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.55 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|