C28H31ClN4O4 — CID 2951073
N-(2-adamantyl)-4-[4-(3-chlorobenzoyl)piperazin-1-yl]-3-nitrobenzamide (PubChem CID 2951073) has the molecular formula C28H31ClN4O4 and a molecular weight of 523.03 g/mol. Its IUPAC name is N-(2-adamantyl)-4-[4-(3-chlorobenzoyl)piperazin-1-yl]-3-nitrobenzamide.
| Compound Name | N-(2-adamantyl)-4-[4-(3-chlorobenzoyl)piperazin-1-yl]-3-nitrobenzamide |
|---|---|
| PubChem CID | 2951073 |
| Molecular Formula | C28H31ClN4O4 |
| Molecular Weight | 523.03 g/mol |
| Exact Mass | 522.20 |
| IUPAC Name | N-(2-adamantyl)-4-[4-(3-chlorobenzoyl)piperazin-1-yl]-3-nitrobenzamide |
| SMILES | O=C(NC1C2CC3CC(C2)CC1C3)c1ccc(N2CCN(C(=O)c3cccc(Cl)c3)CC2)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C28H31ClN4O4/c29-23-3-1-2-20(15-23)28(35)32-8-6-31(7-9-32)24-5-4-19(16-25(24)33(36)37)27(34)30-26-21-11-17-10-18(13-21)14-22(26)12-17/h1-5,15-18,21-22,26H,6-14H2,(H,30,34) |
| InChIKey | UKOHOAPLRSZHAI-UHFFFAOYSA-N |
| XLogP | 4.77 |
| TPSA | 95.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 523.03 |
| LogP ≤ 5 | 4.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|