C23H32N4O3 — CID 7319953
N-[(3S,5R)-3,5-dimethyl-1-adamantyl]-3-nitro-4-piperazin-1-ylbenzamide (PubChem CID 7319953) has the molecular formula C23H32N4O3 and a molecular weight of 412.53 g/mol. Its IUPAC name is N-[(3S,5R)-3,5-dimethyl-1-adamantyl]-3-nitro-4-piperazin-1-ylbenzamide.
| Compound Name | N-[(3S,5R)-3,5-dimethyl-1-adamantyl]-3-nitro-4-piperazin-1-ylbenzamide |
|---|---|
| PubChem CID | 7319953 |
| Molecular Formula | C23H32N4O3 |
| Molecular Weight | 412.53 g/mol |
| Exact Mass | 412.25 |
| IUPAC Name | N-[(3S,5R)-3,5-dimethyl-1-adamantyl]-3-nitro-4-piperazin-1-ylbenzamide |
| SMILES | C[C@]12CC3CC(NC(=O)c4ccc(N5CCNCC5)c([N+](=O)[O-])c4)(C1)C[C@@](C)(C3)C2 |
| InChI | InChI=1S/C23H32N4O3/c1-21-10-16-11-22(2,13-21)15-23(12-16,14-21)25-20(28)17-3-4-18(19(9-17)27(29)30)26-7-5-24-6-8-26/h3-4,9,16,24H,5-8,10-15H2,1-2H3,(H,25,28)/t16?,21-,22+,23? |
| InChIKey | NZWRVXMQYHWDNI-QLOAFGCXSA-N |
| XLogP | 3.48 |
| TPSA | 87.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.53 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|